Pocket-Gen / utils /reconstruct.py
Zaixi's picture
1
dcacefd
"""
https://github.com/mattragoza/liGAN/blob/master/fitting.py
License: GNU General Public License v2.0
https://github.com/mattragoza/liGAN/blob/master/LICENSE
"""
import itertools
import numpy as np
from rdkit.Chem import AllChem as Chem
from rdkit import Geometry
from openbabel import openbabel as ob
from scipy.spatial.distance import pdist
from scipy.spatial.distance import squareform
class MolReconsError(Exception):
pass
def reachable_r(a, b, seenbonds):
'''Recursive helper.'''
for nbr in ob.OBAtomAtomIter(a):
bond = a.GetBond(nbr).GetIdx()
if bond not in seenbonds:
seenbonds.add(bond)
if nbr == b:
return True
elif reachable_r(nbr, b, seenbonds):
return True
return False
def reachable(a, b):
'''Return true if atom b is reachable from a without using the bond between them.'''
if a.GetExplicitDegree() == 1 or b.GetExplicitDegree() == 1:
return False # this is the _only_ bond for one atom
# otherwise do recursive traversal
seenbonds = set([a.GetBond(b).GetIdx()])
return reachable_r(a, b, seenbonds)
def forms_small_angle(a, b, cutoff=60):
'''Return true if bond between a and b is part of a small angle
with a neighbor of a only.'''
for nbr in ob.OBAtomAtomIter(a):
if nbr != b:
degrees = b.GetAngle(a, nbr)
if degrees < cutoff:
return True
return False
def make_obmol(xyz, atomic_numbers):
mol = ob.OBMol()
mol.BeginModify()
atoms = []
for xyz, t in zip(xyz, atomic_numbers):
x, y, z = xyz
# ch = struct.channels[t]
atom = mol.NewAtom()
atom.SetAtomicNum(t)
atom.SetVector(x, y, z)
atoms.append(atom)
return mol, atoms
def connect_the_dots(mol, atoms, indicators, covalent_factor=1.3):
'''Custom implementation of ConnectTheDots. This is similar to
OpenBabel's version, but is more willing to make long bonds
(up to maxbond long) to keep the molecule connected. It also
attempts to respect atom type information from struct.
atoms and struct need to correspond in their order
Assumes no hydrogens or existing bonds.
'''
"""
for now, indicators only include 'is_aromatic'
"""
pt = Chem.GetPeriodicTable()
if len(atoms) == 0:
return
mol.BeginModify()
# just going to to do n^2 comparisons, can worry about efficiency later
coords = np.array([(a.GetX(), a.GetY(), a.GetZ()) for a in atoms])
dists = squareform(pdist(coords))
# types = [struct.channels[t].name for t in struct.c]
for i, j in itertools.combinations(range(len(atoms)), 2):
a = atoms[i]
b = atoms[j]
a_r = ob.GetCovalentRad(a.GetAtomicNum()) * covalent_factor
b_r = ob.GetCovalentRad(b.GetAtomicNum()) * covalent_factor
if dists[i, j] < a_r + b_r:
flag = 0
if indicators and indicators[i] and indicators[j]:
flag = ob.OB_AROMATIC_BOND
mol.AddBond(a.GetIdx(), b.GetIdx(), 1, flag)
atom_maxb = {}
for (i, a) in enumerate(atoms):
# set max valance to the smallest max allowed by openbabel or rdkit
# since we want the molecule to be valid for both (rdkit is usually lower)
maxb = min(ob.GetMaxBonds(a.GetAtomicNum()), pt.GetDefaultValence(a.GetAtomicNum()))
if a.GetAtomicNum() == 16: # sulfone check
if count_nbrs_of_elem(a, 8) >= 2:
maxb = 6
# if indicators[i][ATOM_FAMILIES_ID['Donor']]:
# maxb -= 1 #leave room for hydrogen
# if 'Donor' in types[i]:
# maxb -= 1 #leave room for hydrogen
atom_maxb[a.GetIdx()] = maxb
# remove any impossible bonds between halogens
for bond in ob.OBMolBondIter(mol):
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
if atom_maxb[a1.GetIdx()] == 1 and atom_maxb[a2.GetIdx()] == 1:
mol.DeleteBond(bond)
def get_bond_info(biter):
'''Return bonds sorted by their distortion'''
bonds = [b for b in biter]
binfo = []
for bond in bonds:
bdist = bond.GetLength()
# compute how far away from optimal we are
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
ideal = ob.GetCovalentRad(a1.GetAtomicNum()) + ob.GetCovalentRad(a2.GetAtomicNum())
stretch = bdist / ideal
binfo.append((stretch, bond))
binfo.sort(reverse=True, key=lambda t: t[0]) # most stretched bonds first
return binfo
binfo = get_bond_info(ob.OBMolBondIter(mol))
# now eliminate geometrically poor bonds
for stretch, bond in binfo:
# can we remove this bond without disconnecting the molecule?
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
# as long as we aren't disconnecting, let's remove things
# that are excessively far away (0.45 from ConnectTheDots)
# get bonds to be less than max allowed
# also remove tight angles, because that is what ConnectTheDots does
if stretch > 1.2 or forms_small_angle(a1, a2) or forms_small_angle(a2, a1):
# don't fragment the molecule
if not reachable(a1, a2):
continue
mol.DeleteBond(bond)
# prioritize removing hypervalency causing bonds, do more valent
# constrained atoms first since their bonds introduce the most problems
# with reachability (e.g. oxygen)
hypers = [(atom_maxb[a.GetIdx()], a.GetExplicitValence() - atom_maxb[a.GetIdx()], a) for a in atoms]
hypers = sorted(hypers, key=lambda aa: (aa[0], -aa[1]))
for mb, diff, a in hypers:
if a.GetExplicitValence() <= atom_maxb[a.GetIdx()]:
continue
binfo = get_bond_info(ob.OBAtomBondIter(a))
for stretch, bond in binfo:
if stretch < 0.9: # the two atoms are too closed to remove the bond
continue
# can we remove this bond without disconnecting the molecule?
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
# get right valence
if a1.GetExplicitValence() > atom_maxb[a1.GetIdx()] or a2.GetExplicitValence() > atom_maxb[a2.GetIdx()]:
# don't fragment the molecule
if not reachable(a1, a2):
continue
mol.DeleteBond(bond)
if a.GetExplicitValence() <= atom_maxb[a.GetIdx()]:
break # let nbr atoms choose what bonds to throw out
mol.EndModify()
def convert_ob_mol_to_rd_mol(ob_mol, struct=None):
'''Convert OBMol to RDKit mol, fixing up issues'''
ob_mol.DeleteHydrogens()
n_atoms = ob_mol.NumAtoms()
rd_mol = Chem.RWMol()
rd_conf = Chem.Conformer(n_atoms)
for ob_atom in ob.OBMolAtomIter(ob_mol):
rd_atom = Chem.Atom(ob_atom.GetAtomicNum())
# TODO copy format charge
if ob_atom.IsAromatic() and ob_atom.IsInRing() and ob_atom.MemberOfRingSize() <= 6:
# don't commit to being aromatic unless rdkit will be okay with the ring status
# (this can happen if the atoms aren't fit well enough)
rd_atom.SetIsAromatic(True)
i = rd_mol.AddAtom(rd_atom)
ob_coords = ob_atom.GetVector()
x = ob_coords.GetX()
y = ob_coords.GetY()
z = ob_coords.GetZ()
rd_coords = Geometry.Point3D(x, y, z)
rd_conf.SetAtomPosition(i, rd_coords)
rd_mol.AddConformer(rd_conf)
for ob_bond in ob.OBMolBondIter(ob_mol):
i = ob_bond.GetBeginAtomIdx() - 1
j = ob_bond.GetEndAtomIdx() - 1
bond_order = ob_bond.GetBondOrder()
if bond_order == 1:
rd_mol.AddBond(i, j, Chem.BondType.SINGLE)
elif bond_order == 2:
rd_mol.AddBond(i, j, Chem.BondType.DOUBLE)
elif bond_order == 3:
rd_mol.AddBond(i, j, Chem.BondType.TRIPLE)
else:
raise Exception('unknown bond order {}'.format(bond_order))
if ob_bond.IsAromatic():
bond = rd_mol.GetBondBetweenAtoms(i, j)
bond.SetIsAromatic(True)
rd_mol = Chem.RemoveHs(rd_mol, sanitize=False)
pt = Chem.GetPeriodicTable()
# if double/triple bonds are connected to hypervalent atoms, decrement the order
positions = rd_mol.GetConformer().GetPositions()
nonsingles = []
for bond in rd_mol.GetBonds():
if bond.GetBondType() == Chem.BondType.DOUBLE or bond.GetBondType() == Chem.BondType.TRIPLE:
i = bond.GetBeginAtomIdx()
j = bond.GetEndAtomIdx()
dist = np.linalg.norm(positions[i] - positions[j])
nonsingles.append((dist, bond))
nonsingles.sort(reverse=True, key=lambda t: t[0])
for (d, bond) in nonsingles:
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
if calc_valence(a1) > pt.GetDefaultValence(a1.GetAtomicNum()) or \
calc_valence(a2) > pt.GetDefaultValence(a2.GetAtomicNum()):
btype = Chem.BondType.SINGLE
if bond.GetBondType() == Chem.BondType.TRIPLE:
btype = Chem.BondType.DOUBLE
bond.SetBondType(btype)
for atom in rd_mol.GetAtoms():
# set nitrogens with 4 neighbors to have a charge
if atom.GetAtomicNum() == 7 and atom.GetDegree() == 4:
atom.SetFormalCharge(1)
rd_mol = Chem.AddHs(rd_mol, addCoords=True)
positions = rd_mol.GetConformer().GetPositions()
center = np.mean(positions[np.all(np.isfinite(positions), axis=1)], axis=0)
for atom in rd_mol.GetAtoms():
i = atom.GetIdx()
pos = positions[i]
if not np.all(np.isfinite(pos)):
# hydrogens on C fragment get set to nan (shouldn't, but they do)
rd_mol.GetConformer().SetAtomPosition(i, center)
try:
Chem.SanitizeMol(rd_mol, Chem.SANITIZE_ALL ^ Chem.SANITIZE_KEKULIZE)
except:
raise MolReconsError()
# try:
# Chem.SanitizeMol(rd_mol,Chem.SANITIZE_ALL^Chem.SANITIZE_KEKULIZE)
# except: # mtr22 - don't assume mols will pass this
# pass
# # dkoes - but we want to make failures as rare as possible and should debug them
# m = pybel.Molecule(ob_mol)
# i = np.random.randint(1000000)
# outname = 'bad%d.sdf'%i
# print("WRITING",outname)
# m.write('sdf',outname,overwrite=True)
# pickle.dump(struct,open('bad%d.pkl'%i,'wb'))
# but at some point stop trying to enforce our aromaticity -
# openbabel and rdkit have different aromaticity models so they
# won't always agree. Remove any aromatic bonds to non-aromatic atoms
for bond in rd_mol.GetBonds():
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
if bond.GetIsAromatic():
if not a1.GetIsAromatic() or not a2.GetIsAromatic():
bond.SetIsAromatic(False)
elif a1.GetIsAromatic() and a2.GetIsAromatic():
bond.SetIsAromatic(True)
return rd_mol
def calc_valence(rdatom):
'''Can call GetExplicitValence before sanitize, but need to
know this to fix up the molecule to prevent sanitization failures'''
cnt = 0.0
for bond in rdatom.GetBonds():
cnt += bond.GetBondTypeAsDouble()
return cnt
def count_nbrs_of_elem(atom, atomic_num):
'''
Count the number of neighbors atoms
of atom with the given atomic_num.
'''
count = 0
for nbr in ob.OBAtomAtomIter(atom):
if nbr.GetAtomicNum() == atomic_num:
count += 1
return count
def fixup(atoms, mol, indicators):
'''Set atom properties to match channel. Keep doing this
to beat openbabel over the head with what we want to happen.'''
"""
for now, indicators only include 'is_aromatic'
"""
mol.SetAromaticPerceived(True) # avoid perception
for i, atom in enumerate(atoms):
# ch = struct.channels[t]
if indicators is not None:
if indicators[i]:
atom.SetAromatic(True)
atom.SetHyb(2)
else:
atom.SetAromatic(False)
# if ind[ATOM_FAMILIES_ID['Donor']]:
# if atom.GetExplicitDegree() == atom.GetHvyDegree():
# if atom.GetHvyDegree() == 1 and atom.GetAtomicNum() == 7:
# atom.SetImplicitHCount(2)
# else:
# atom.SetImplicitHCount(1)
# elif ind[ATOM_FAMILIES_ID['Acceptor']]: # NOT AcceptorDonor because of else
# atom.SetImplicitHCount(0)
if (atom.GetAtomicNum() in (7, 8)) and atom.IsInRing(): # Nitrogen, Oxygen
# this is a little iffy, ommitting until there is more evidence it is a net positive
# we don't have aromatic types for nitrogen, but if it
# is in a ring with aromatic carbon mark it aromatic as well
acnt = 0
for nbr in ob.OBAtomAtomIter(atom):
if nbr.IsAromatic():
acnt += 1
if acnt > 1:
atom.SetAromatic(True)
def raw_obmol_from_generated(data):
xyz = data.ligand_context_pos.clone().cpu().tolist()
atomic_nums = data.ligand_context_element.clone().cpu().tolist()
# indicators = data.ligand_context_feature_full[:, -len(ATOM_FAMILIES_ID):].clone().cpu().bool().tolist()
mol, atoms = make_obmol(xyz, atomic_nums)
return mol, atoms
UPGRADE_BOND_ORDER = {Chem.BondType.SINGLE: Chem.BondType.DOUBLE, Chem.BondType.DOUBLE: Chem.BondType.TRIPLE}
def postprocess_rd_mol_1(rdmol):
rdmol = Chem.RemoveHs(rdmol)
# Construct bond nbh list
nbh_list = {}
for bond in rdmol.GetBonds():
begin, end = bond.GetBeginAtomIdx(), bond.GetEndAtomIdx()
if begin not in nbh_list:
nbh_list[begin] = [end]
else:
nbh_list[begin].append(end)
if end not in nbh_list:
nbh_list[end] = [begin]
else:
nbh_list[end].append(begin)
# Fix missing bond-order
for atom in rdmol.GetAtoms():
idx = atom.GetIdx()
num_radical = atom.GetNumRadicalElectrons()
if num_radical > 0:
for j in nbh_list[idx]:
if j <= idx: continue
nb_atom = rdmol.GetAtomWithIdx(j)
nb_radical = nb_atom.GetNumRadicalElectrons()
if nb_radical > 0:
bond = rdmol.GetBondBetweenAtoms(idx, j)
bond.SetBondType(UPGRADE_BOND_ORDER[bond.GetBondType()])
nb_atom.SetNumRadicalElectrons(nb_radical - 1)
num_radical -= 1
atom.SetNumRadicalElectrons(num_radical)
num_radical = atom.GetNumRadicalElectrons()
if num_radical > 0:
atom.SetNumRadicalElectrons(0)
num_hs = atom.GetNumExplicitHs()
atom.SetNumExplicitHs(num_hs + num_radical)
return rdmol
def postprocess_rd_mol_2(rdmol):
rdmol_edit = Chem.RWMol(rdmol)
ring_info = rdmol.GetRingInfo()
ring_info.AtomRings()
rings = [set(r) for r in ring_info.AtomRings()]
for i, ring_a in enumerate(rings):
if len(ring_a) == 3:
non_carbon = []
atom_by_symb = {}
for atom_idx in ring_a:
symb = rdmol.GetAtomWithIdx(atom_idx).GetSymbol()
if symb != 'C':
non_carbon.append(atom_idx)
if symb not in atom_by_symb:
atom_by_symb[symb] = [atom_idx]
else:
atom_by_symb[symb].append(atom_idx)
if len(non_carbon) == 2:
rdmol_edit.RemoveBond(*non_carbon)
if 'O' in atom_by_symb and len(atom_by_symb['O']) == 2:
rdmol_edit.RemoveBond(*atom_by_symb['O'])
rdmol_edit.GetAtomWithIdx(atom_by_symb['O'][0]).SetNumExplicitHs(
rdmol_edit.GetAtomWithIdx(atom_by_symb['O'][0]).GetNumExplicitHs() + 1
)
rdmol_edit.GetAtomWithIdx(atom_by_symb['O'][1]).SetNumExplicitHs(
rdmol_edit.GetAtomWithIdx(atom_by_symb['O'][1]).GetNumExplicitHs() + 1
)
rdmol = rdmol_edit.GetMol()
for atom in rdmol.GetAtoms():
if atom.GetFormalCharge() > 0:
atom.SetFormalCharge(0)
return rdmol
def reconstruct_from_generated(xyz, atomic_nums, aromatic=None, basic_mode=True):
"""
will utilize data.ligand_pos, data.ligand_element, data.ligand_atom_feature_full to reconstruct mol
"""
# xyz = data.ligand_pos.clone().cpu().tolist()
# atomic_nums = data.ligand_element.clone().cpu().tolist()
# indicators = data.ligand_atom_feature_full[:, -len(ATOM_FAMILIES_ID):].clone().cpu().bool().tolist()
# indicators = None
if basic_mode:
indicators = None
else:
indicators = aromatic
mol, atoms = make_obmol(xyz, atomic_nums)
fixup(atoms, mol, indicators)
connect_the_dots(mol, atoms, indicators, covalent_factor=1.3)
fixup(atoms, mol, indicators)
mol.AddPolarHydrogens()
mol.PerceiveBondOrders()
fixup(atoms, mol, indicators)
for (i, a) in enumerate(atoms):
ob.OBAtomAssignTypicalImplicitHydrogens(a)
fixup(atoms, mol, indicators)
mol.AddHydrogens()
fixup(atoms, mol, indicators)
# make rings all aromatic if majority of carbons are aromatic
for ring in ob.OBMolRingIter(mol):
if 5 <= ring.Size() <= 6:
carbon_cnt = 0
aromatic_ccnt = 0
for ai in ring._path:
a = mol.GetAtom(ai)
if a.GetAtomicNum() == 6:
carbon_cnt += 1
if a.IsAromatic():
aromatic_ccnt += 1
if aromatic_ccnt >= carbon_cnt / 2 and aromatic_ccnt != ring.Size():
# set all ring atoms to be aromatic
for ai in ring._path:
a = mol.GetAtom(ai)
a.SetAromatic(True)
# bonds must be marked aromatic for smiles to match
for bond in ob.OBMolBondIter(mol):
a1 = bond.GetBeginAtom()
a2 = bond.GetEndAtom()
if a1.IsAromatic() and a2.IsAromatic():
bond.SetAromatic(True)
mol.PerceiveBondOrders()
rd_mol = convert_ob_mol_to_rd_mol(mol)
try:
# Post-processing
rd_mol = postprocess_rd_mol_1(rd_mol)
rd_mol = postprocess_rd_mol_2(rd_mol)
except:
raise MolReconsError()
return rd_mol